C19H27NO — CID 173442268
1,1-diphenylheptan-2-amine;hydrate (PubChem CID 173442268) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is 1,1-diphenylheptan-2-amine;hydrate.
| Compound Name | 1,1-diphenylheptan-2-amine;hydrate |
|---|---|
| PubChem CID | 173442268 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 1,1-diphenylheptan-2-amine;hydrate |
| SMILES | CCCCCC(N)C(c1ccccc1)c1ccccc1.O |
| InChI | InChI=1S/C19H25N.H2O/c1-2-3-6-15-18(20)19(16-11-7-4-8-12-16)17-13-9-5-10-14-17;/h4-5,7-14,18-19H,2-3,6,15,20H2,1H3;1H2 |
| InChIKey | GVRDELMYIHBVIK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|