C20H27N — CID 63412141
4-methyl-1,1-diphenylheptan-2-amine (PubChem CID 63412141) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is 4-methyl-1,1-diphenylheptan-2-amine.
| Compound Name | 4-methyl-1,1-diphenylheptan-2-amine |
|---|---|
| PubChem CID | 63412141 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 4-methyl-1,1-diphenylheptan-2-amine |
| SMILES | CCCC(C)CC(N)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H27N/c1-3-10-16(2)15-19(21)20(17-11-6-4-7-12-17)18-13-8-5-9-14-18/h4-9,11-14,16,19-20H,3,10,15,21H2,1-2H3 |
| InChIKey | KVQIRMNIMQMHOJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |