C18H25NO — CID 173442178
1,1-diphenylhexan-2-amine;hydrate (PubChem CID 173442178) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 1,1-diphenylhexan-2-amine;hydrate.
| Compound Name | 1,1-diphenylhexan-2-amine;hydrate |
|---|---|
| PubChem CID | 173442178 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 1,1-diphenylhexan-2-amine;hydrate |
| SMILES | CCCCC(N)C(c1ccccc1)c1ccccc1.O |
| InChI | InChI=1S/C18H23N.H2O/c1-2-3-14-17(19)18(15-10-6-4-7-11-15)16-12-8-5-9-13-16;/h4-13,17-18H,2-3,14,19H2,1H3;1H2 |
| InChIKey | IUPKJLDFZDPMFI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |