C19H25N — CID 83047736
2-methyl-1,1-diphenylhexan-3-amine (PubChem CID 83047736) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 2-methyl-1,1-diphenylhexan-3-amine.
| Compound Name | 2-methyl-1,1-diphenylhexan-3-amine |
|---|---|
| PubChem CID | 83047736 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 2-methyl-1,1-diphenylhexan-3-amine |
| SMILES | CCCC(N)C(C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H25N/c1-3-10-18(20)15(2)19(16-11-6-4-7-12-16)17-13-8-5-9-14-17/h4-9,11-15,18-19H,3,10,20H2,1-2H3 |
| InChIKey | JXTITASCZRHAGY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |