C21H31NO — CID 173441575
1,1-diphenylnonan-2-amine;hydrate (PubChem CID 173441575) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is 1,1-diphenylnonan-2-amine;hydrate.
| Compound Name | 1,1-diphenylnonan-2-amine;hydrate |
|---|---|
| PubChem CID | 173441575 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | 1,1-diphenylnonan-2-amine;hydrate |
| SMILES | CCCCCCCC(N)C(c1ccccc1)c1ccccc1.O |
| InChI | InChI=1S/C21H29N.H2O/c1-2-3-4-5-12-17-20(22)21(18-13-8-6-9-14-18)19-15-10-7-11-16-19;/h6-11,13-16,20-21H,2-5,12,17,22H2,1H3;1H2 |
| InChIKey | MNXCULXAFYGLFS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|