C19H26N2 — CID 174986807
2-methyl-6,6-diphenylhexane-1,5-diamine (PubChem CID 174986807) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-methyl-6,6-diphenylhexane-1,5-diamine.
| Compound Name | 2-methyl-6,6-diphenylhexane-1,5-diamine |
|---|---|
| PubChem CID | 174986807 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 2-methyl-6,6-diphenylhexane-1,5-diamine |
| SMILES | CC(CN)CCC(N)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H26N2/c1-15(14-20)12-13-18(21)19(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,15,18-19H,12-14,20-21H2,1H3 |
| InChIKey | BXNZVDHINSYVSJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |