C9H24N4 — CID 57229411
2-methyloctane-1,5,6,7-tetramine (PubChem CID 57229411) has the molecular formula C9H24N4 and a molecular weight of 188.32 g/mol. Its IUPAC name is 2-methyloctane-1,5,6,7-tetramine.
| Compound Name | 2-methyloctane-1,5,6,7-tetramine |
|---|---|
| PubChem CID | 57229411 |
| Molecular Formula | C9H24N4 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.20 |
| IUPAC Name | 2-methyloctane-1,5,6,7-tetramine |
| SMILES | CC(CN)CCC(N)C(N)C(C)N |
| InChI | InChI=1S/C9H24N4/c1-6(5-10)3-4-8(12)9(13)7(2)11/h6-9H,3-5,10-13H2,1-2H3 |
| InChIKey | USGUKPUABRGABI-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |