About 2-methylpentane-1,3,4-triamine
2-methylpentane-1,3,4-triamine (PubChem CID 172814468) has the molecular formula C6H17N3
and a molecular weight of 131.22 g/mol. Its IUPAC name is 2-methylpentane-1,3,4-triamine.
Molecular Properties
| Compound Name | 2-methylpentane-1,3,4-triamine |
| PubChem CID | 172814468 |
| Molecular Formula | C6H17N3 |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.14 |
| IUPAC Name | 2-methylpentane-1,3,4-triamine |
| SMILES | CC(N)C(N)C(C)CN |
| InChI | InChI=1S/C6H17N3/c1-4(3-7)6(9)5(2)8/h4-6H,3,7-9H2,1-2H3 |
| InChIKey | SPYJLBKSFXLITJ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpentane-1,3,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentane-1,3,4-triamine?
The IUPAC name of 2-methylpentane-1,3,4-triamine (CID 172814468) is 2-methylpentane-1,3,4-triamine.
What is the SMILES notation for 2-methylpentane-1,3,4-triamine?
The canonical SMILES for 2-methylpentane-1,3,4-triamine is CC(N)C(N)C(C)CN.
What is the InChIKey of 2-methylpentane-1,3,4-triamine?
The InChIKey is SPYJLBKSFXLITJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H17N3/c1-4(3-7)6(9)5(2)8/h4-6H,3,7-9H2,1-2H3.
What are the key properties of 2-methylpentane-1,3,4-triamine?
2-methylpentane-1,3,4-triamine has a molecular weight of 131.22 g/mol, XLogP of -0.74, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentane-1,3,4-triamine is sourced from PubChem (CID 172814468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).