C8H24N2O3Si — CID 173127795
2-methylbutane-1,3-diamine;trimethoxysilane (PubChem CID 173127795) has the molecular formula C8H24N2O3Si and a molecular weight of 224.38 g/mol. Its IUPAC name is 2-methylbutane-1,3-diamine;trimethoxysilane.
| Compound Name | 2-methylbutane-1,3-diamine;trimethoxysilane |
|---|---|
| PubChem CID | 173127795 |
| Molecular Formula | C8H24N2O3Si |
| Molecular Weight | 224.38 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2-methylbutane-1,3-diamine;trimethoxysilane |
| SMILES | CC(N)C(C)CN.CO[SiH](OC)OC |
| InChI | InChI=1S/C5H14N2.C3H10O3Si/c1-4(3-6)5(2)7;1-4-7(5-2)6-3/h4-5H,3,6-7H2,1-2H3;7H,1-3H3 |
| InChIKey | MVTICAMSFCXPRT-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.38 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|