About dimethoxy(pentyl)silane;propan-2-amine
dimethoxy(pentyl)silane;propan-2-amine (PubChem CID 175239274) has the molecular formula C10H27NO2Si
and a molecular weight of 221.42 g/mol. Its IUPAC name is dimethoxy(pentyl)silane;propan-2-amine.
Molecular Properties
| Compound Name | dimethoxy(pentyl)silane;propan-2-amine |
| PubChem CID | 175239274 |
| Molecular Formula | C10H27NO2Si |
| Molecular Weight | 221.42 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | dimethoxy(pentyl)silane;propan-2-amine |
| SMILES | CC(C)N.CCCCC[SiH](OC)OC |
| InChI | InChI=1S/C7H18O2Si.C3H9N/c1-4-5-6-7-10(8-2)9-3;1-3(2)4/h10H,4-7H2,1-3H3;3H,4H2,1-2H3 |
| InChIKey | SYHSUOZYZPATGP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy(pentyl)silane;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy(pentyl)silane;propan-2-amine?
The IUPAC name of dimethoxy(pentyl)silane;propan-2-amine (CID 175239274) is dimethoxy(pentyl)silane;propan-2-amine.
What is the SMILES notation for dimethoxy(pentyl)silane;propan-2-amine?
The canonical SMILES for dimethoxy(pentyl)silane;propan-2-amine is CC(C)N.CCCCC[SiH](OC)OC.
What is the InChIKey of dimethoxy(pentyl)silane;propan-2-amine?
The InChIKey is SYHSUOZYZPATGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18O2Si.C3H9N/c1-4-5-6-7-10(8-2)9-3;1-3(2)4/h10H,4-7H2,1-3H3;3H,4H2,1-2H3.
What are the key properties of dimethoxy(pentyl)silane;propan-2-amine?
dimethoxy(pentyl)silane;propan-2-amine has a molecular weight of 221.42 g/mol, XLogP of 2.04, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy(pentyl)silane;propan-2-amine is sourced from PubChem (CID 175239274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).