About dimethoxy(pentyl)silane;methanamine
dimethoxy(pentyl)silane;methanamine (PubChem CID 175165037) has the molecular formula C8H23NO2Si
and a molecular weight of 193.36 g/mol. Its IUPAC name is dimethoxy(pentyl)silane;methanamine.
Molecular Properties
| Compound Name | dimethoxy(pentyl)silane;methanamine |
| PubChem CID | 175165037 |
| Molecular Formula | C8H23NO2Si |
| Molecular Weight | 193.36 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | dimethoxy(pentyl)silane;methanamine |
| SMILES | CCCCC[SiH](OC)OC.CN |
| InChI | InChI=1S/C7H18O2Si.CH5N/c1-4-5-6-7-10(8-2)9-3;1-2/h10H,4-7H2,1-3H3;2H2,1H3 |
| InChIKey | FAICEACOBMTIOD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy(pentyl)silane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy(pentyl)silane;methanamine?
The IUPAC name of dimethoxy(pentyl)silane;methanamine (CID 175165037) is dimethoxy(pentyl)silane;methanamine.
What is the SMILES notation for dimethoxy(pentyl)silane;methanamine?
The canonical SMILES for dimethoxy(pentyl)silane;methanamine is CCCCC[SiH](OC)OC.CN.
What is the InChIKey of dimethoxy(pentyl)silane;methanamine?
The InChIKey is FAICEACOBMTIOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18O2Si.CH5N/c1-4-5-6-7-10(8-2)9-3;1-2/h10H,4-7H2,1-3H3;2H2,1H3.
What are the key properties of dimethoxy(pentyl)silane;methanamine?
dimethoxy(pentyl)silane;methanamine has a molecular weight of 193.36 g/mol, XLogP of 1.26, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy(pentyl)silane;methanamine is sourced from PubChem (CID 175165037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).