About dimethoxy(3-methylbutyl)silane;ethanamine
dimethoxy(3-methylbutyl)silane;ethanamine (PubChem CID 173025352) has the molecular formula C9H25NO2Si
and a molecular weight of 207.39 g/mol. Its IUPAC name is dimethoxy(3-methylbutyl)silane;ethanamine.
Molecular Properties
| Compound Name | dimethoxy(3-methylbutyl)silane;ethanamine |
| PubChem CID | 173025352 |
| Molecular Formula | C9H25NO2Si |
| Molecular Weight | 207.39 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | dimethoxy(3-methylbutyl)silane;ethanamine |
| SMILES | CCN.CO[SiH](CCC(C)C)OC |
| InChI | InChI=1S/C7H18O2Si.C2H7N/c1-7(2)5-6-10(8-3)9-4;1-2-3/h7,10H,5-6H2,1-4H3;2-3H2,1H3 |
| InChIKey | LKAFWNNWRXJWQV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy(3-methylbutyl)silane;ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy(3-methylbutyl)silane;ethanamine?
The IUPAC name of dimethoxy(3-methylbutyl)silane;ethanamine (CID 173025352) is dimethoxy(3-methylbutyl)silane;ethanamine.
What is the SMILES notation for dimethoxy(3-methylbutyl)silane;ethanamine?
The canonical SMILES for dimethoxy(3-methylbutyl)silane;ethanamine is CCN.CO[SiH](CCC(C)C)OC.
What is the InChIKey of dimethoxy(3-methylbutyl)silane;ethanamine?
The InChIKey is LKAFWNNWRXJWQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18O2Si.C2H7N/c1-7(2)5-6-10(8-3)9-4;1-2-3/h7,10H,5-6H2,1-4H3;2-3H2,1H3.
What are the key properties of dimethoxy(3-methylbutyl)silane;ethanamine?
dimethoxy(3-methylbutyl)silane;ethanamine has a molecular weight of 207.39 g/mol, XLogP of 1.51, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy(3-methylbutyl)silane;ethanamine is sourced from PubChem (CID 173025352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).