C9H26N4O2Si — CID 173120375
1-N,1-N'-bis(2-aminoethyl)-3-dimethoxysilylpropane-1,1-diamine (PubChem CID 173120375) has the molecular formula C9H26N4O2Si and a molecular weight of 250.42 g/mol. Its IUPAC name is 1-N,1-N'-bis(2-aminoethyl)-3-dimethoxysilylpropane-1,1-diamine.
| Compound Name | 1-N,1-N'-bis(2-aminoethyl)-3-dimethoxysilylpropane-1,1-diamine |
|---|---|
| PubChem CID | 173120375 |
| Molecular Formula | C9H26N4O2Si |
| Molecular Weight | 250.42 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 1-N,1-N'-bis(2-aminoethyl)-3-dimethoxysilylpropane-1,1-diamine |
| SMILES | CO[SiH](CCC(NCCN)NCCN)OC |
| InChI | InChI=1S/C9H26N4O2Si/c1-14-16(15-2)8-3-9(12-6-4-10)13-7-5-11/h9,12-13,16H,3-8,10-11H2,1-2H3 |
| InChIKey | BOBPXVWHDLWIOE-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.42 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|