C9H20Br2O2Si — CID 173330764
(4,5-dibromo-3,4-dimethylpentyl)-dimethoxysilane (PubChem CID 173330764) has the molecular formula C9H20Br2O2Si and a molecular weight of 348.15 g/mol. Its IUPAC name is (4,5-dibromo-3,4-dimethylpentyl)-dimethoxysilane.
| Compound Name | (4,5-dibromo-3,4-dimethylpentyl)-dimethoxysilane |
|---|---|
| PubChem CID | 173330764 |
| Molecular Formula | C9H20Br2O2Si |
| Molecular Weight | 348.15 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | (4,5-dibromo-3,4-dimethylpentyl)-dimethoxysilane |
| SMILES | CO[SiH](CCC(C)C(C)(Br)CBr)OC |
| InChI | InChI=1S/C9H20Br2O2Si/c1-8(9(2,11)7-10)5-6-14(12-3)13-4/h8,14H,5-7H2,1-4H3 |
| InChIKey | PSPMDMFIZXTKTM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.15 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|