C6H11F5O2Si — CID 173012139
dimethoxy(3,3,4,4,4-pentafluorobutyl)silane (PubChem CID 173012139) has the molecular formula C6H11F5O2Si and a molecular weight of 238.23 g/mol. Its IUPAC name is dimethoxy(3,3,4,4,4-pentafluorobutyl)silane.
| Compound Name | dimethoxy(3,3,4,4,4-pentafluorobutyl)silane |
|---|---|
| PubChem CID | 173012139 |
| Molecular Formula | C6H11F5O2Si |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | dimethoxy(3,3,4,4,4-pentafluorobutyl)silane |
| SMILES | CO[SiH](CCC(F)(F)C(F)(F)F)OC |
| InChI | InChI=1S/C6H11F5O2Si/c1-12-14(13-2)4-3-5(7,8)6(9,10)11/h14H,3-4H2,1-2H3 |
| InChIKey | HVRXHVOZXNHRKJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|