C6H12F6O3Si — CID 175523544
1,1,1,2,2,3-hexafluoropropane;trimethoxysilane (PubChem CID 175523544) has the molecular formula C6H12F6O3Si and a molecular weight of 274.23 g/mol. Its IUPAC name is 1,1,1,2,2,3-hexafluoropropane;trimethoxysilane.
| Compound Name | 1,1,1,2,2,3-hexafluoropropane;trimethoxysilane |
|---|---|
| PubChem CID | 175523544 |
| Molecular Formula | C6H12F6O3Si |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 1,1,1,2,2,3-hexafluoropropane;trimethoxysilane |
| SMILES | CO[SiH](OC)OC.FCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C3H2F6.C3H10O3Si/c4-1-2(5,6)3(7,8)9;1-4-7(5-2)6-3/h1H2;7H,1-3H3 |
| InChIKey | VZCNHJQFIYSKMG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|