C7H11F9O — CID 158386104
methoxymethane;1,1,1,2,2-pentafluoropropane;1,1,1,2-tetrafluoroethane (PubChem CID 158386104) has the molecular formula C7H11F9O and a molecular weight of 282.15 g/mol. Its IUPAC name is methoxymethane;1,1,1,2,2-pentafluoropropane;1,1,1,2-tetrafluoroethane.
| Compound Name | methoxymethane;1,1,1,2,2-pentafluoropropane;1,1,1,2-tetrafluoroethane |
|---|---|
| PubChem CID | 158386104 |
| Molecular Formula | C7H11F9O |
| Molecular Weight | 282.15 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | methoxymethane;1,1,1,2,2-pentafluoropropane;1,1,1,2-tetrafluoroethane |
| SMILES | CC(F)(F)C(F)(F)F.COC.FCC(F)(F)F |
| InChI | InChI=1S/C3H3F5.C2H2F4.C2H6O/c1-2(4,5)3(6,7)8;3-1-2(4,5)6;1-3-2/h1H3;1H2;1-2H3 |
| InChIKey | GWJVPDABSHDNEP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.15 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|