C12H12F18O2 — CID 175408970
1,1,1,2,3,3,4-heptafluoro-4-(1,2,2,3,4,4,4-heptafluorobutoxy)butane;methoxymethane;1,1,1,2-tetrafluoroethane (PubChem CID 175408970) has the molecular formula C12H12F18O2 and a molecular weight of 530.19 g/mol. Its IUPAC name is 1,1,1,2,3,3,4-heptafluoro-4-(1,2,2,3,4,4,4-heptafluorobutoxy)butane;methoxymethane;1,1,1,2-tetrafluoroethane.
| Compound Name | 1,1,1,2,3,3,4-heptafluoro-4-(1,2,2,3,4,4,4-heptafluorobutoxy)butane;methoxymethane;1,1,1,2-tetrafluoroethane |
|---|---|
| PubChem CID | 175408970 |
| Molecular Formula | C12H12F18O2 |
| Molecular Weight | 530.19 g/mol |
| Exact Mass | 530.05 |
| IUPAC Name | 1,1,1,2,3,3,4-heptafluoro-4-(1,2,2,3,4,4,4-heptafluorobutoxy)butane;methoxymethane;1,1,1,2-tetrafluoroethane |
| SMILES | COC.FC(OC(F)C(F)(F)C(F)C(F)(F)F)C(F)(F)C(F)C(F)(F)F.FCC(F)(F)F |
| InChI | InChI=1S/C8H4F14O.C2H2F4.C2H6O/c9-1(7(17,18)19)5(13,14)3(11)23-4(12)6(15,16)2(10)8(20,21)22;3-1-2(4,5)6;1-3-2/h1-4H;1H2;1-2H3 |
| InChIKey | CLMMDNZDTAFVMK-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.19 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |