C5H4F8 — CID 86184237
1,1,1,2,3,3,4,5-octafluoropentane (PubChem CID 86184237) has the molecular formula C5H4F8 and a molecular weight of 216.07 g/mol. Its IUPAC name is 1,1,1,2,3,3,4,5-octafluoropentane.
| Compound Name | 1,1,1,2,3,3,4,5-octafluoropentane |
|---|---|
| PubChem CID | 86184237 |
| Molecular Formula | C5H4F8 |
| Molecular Weight | 216.07 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 1,1,1,2,3,3,4,5-octafluoropentane |
| SMILES | FCC(F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C5H4F8/c6-1-2(7)4(9,10)3(8)5(11,12)13/h2-3H,1H2 |
| InChIKey | VJELBLWXGNQGPB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.07 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |