C11H13F11O — CID 130418426
2,3-difluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-3-(trifluoromethyl)pentane (PubChem CID 130418426) has the molecular formula C11H13F11O and a molecular weight of 370.20 g/mol. Its IUPAC name is 2,3-difluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-3-(trifluoromethyl)pentane.
| Compound Name | 2,3-difluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-3-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 130418426 |
| Molecular Formula | C11H13F11O |
| Molecular Weight | 370.20 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 2,3-difluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-3-(trifluoromethyl)pentane |
| SMILES | CC(OC(C)C(F)(C(C)F)C(F)(F)F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C11H13F11O/c1-4(12)8(14,11(20,21)22)5(2)23-6(3)9(15,16)7(13)10(17,18)19/h4-7H,1-3H3 |
| InChIKey | FLCKSCQZHJNUCI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.20 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |