C8H10Cl2F6O — CID 88789392
1-chloro-3-(4-chloro-3,3,4-trifluorobutan-2-yl)oxy-1,2,2-trifluorobutane (PubChem CID 88789392) has the molecular formula C8H10Cl2F6O and a molecular weight of 307.06 g/mol. Its IUPAC name is 1-chloro-3-(4-chloro-3,3,4-trifluorobutan-2-yl)oxy-1,2,2-trifluorobutane.
| Compound Name | 1-chloro-3-(4-chloro-3,3,4-trifluorobutan-2-yl)oxy-1,2,2-trifluorobutane |
|---|---|
| PubChem CID | 88789392 |
| Molecular Formula | C8H10Cl2F6O |
| Molecular Weight | 307.06 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 1-chloro-3-(4-chloro-3,3,4-trifluorobutan-2-yl)oxy-1,2,2-trifluorobutane |
| SMILES | CC(OC(C)C(F)(F)C(F)Cl)C(F)(F)C(F)Cl |
| InChI | InChI=1S/C8H10Cl2F6O/c1-3(7(13,14)5(9)11)17-4(2)8(15,16)6(10)12/h3-6H,1-2H3 |
| InChIKey | FJLLBAUZQBMSAU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.06 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|