C13H18F10N2O — CID 137474645
1-fluoro-4-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]piperazine (PubChem CID 137474645) has the molecular formula C13H18F10N2O and a molecular weight of 408.28 g/mol. Its IUPAC name is 1-fluoro-4-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]piperazine.
| Compound Name | 1-fluoro-4-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]piperazine |
|---|---|
| PubChem CID | 137474645 |
| Molecular Formula | C13H18F10N2O |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 1-fluoro-4-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]piperazine |
| SMILES | CC(OC(C)C(F)(F)C(F)C(F)(F)F)C(F)(F)C(F)N1CCN(F)CC1 |
| InChI | InChI=1S/C13H18F10N2O/c1-7(11(16,17)9(14)13(20,21)22)26-8(2)12(18,19)10(15)24-3-5-25(23)6-4-24/h7-10H,3-6H2,1-2H3 |
| InChIKey | ZBJMATCBWDXUJE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|