C14H20F9NO — CID 130418390
1-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]piperidine (PubChem CID 130418390) has the molecular formula C14H20F9NO and a molecular weight of 389.30 g/mol. Its IUPAC name is 1-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]piperidine.
| Compound Name | 1-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]piperidine |
|---|---|
| PubChem CID | 130418390 |
| Molecular Formula | C14H20F9NO |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 1-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]piperidine |
| SMILES | CC(OC(C)C(F)(F)C(F)C(F)(F)F)C(F)(F)C(F)N1CCCCC1 |
| InChI | InChI=1S/C14H20F9NO/c1-8(12(17,18)10(15)14(21,22)23)25-9(2)13(19,20)11(16)24-6-4-3-5-7-24/h8-11H,3-7H2,1-2H3 |
| InChIKey | SHMSNJIECJHRMX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|