C9H13F6NO — CID 18725553
1-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)piperidine (PubChem CID 18725553) has the molecular formula C9H13F6NO and a molecular weight of 265.20 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)piperidine.
| Compound Name | 1-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)piperidine |
|---|---|
| PubChem CID | 18725553 |
| Molecular Formula | C9H13F6NO |
| Molecular Weight | 265.20 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 1-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)piperidine |
| SMILES | COC(F)(F)C(F)(F)C(F)(F)N1CCCCC1 |
| InChI | InChI=1S/C9H13F6NO/c1-17-9(14,15)7(10,11)8(12,13)16-5-3-2-4-6-16/h2-6H2,1H3 |
| InChIKey | DTUZNNNQNRZJDL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.20 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|