C9H9F10NO — CID 22292469
2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1-methoxypropyl)piperidine (PubChem CID 22292469) has the molecular formula C9H9F10NO and a molecular weight of 337.16 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1-methoxypropyl)piperidine.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1-methoxypropyl)piperidine |
|---|---|
| PubChem CID | 22292469 |
| Molecular Formula | C9H9F10NO |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1-methoxypropyl)piperidine |
| SMILES | CCC(OC)N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H9F10NO/c1-3-4(21-2)20-8(16,17)6(12,13)5(10,11)7(14,15)9(20,18)19/h4H,3H2,1-2H3 |
| InChIKey | XVLJGHGDGCPRBZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|