C10H15F6NO — CID 18725560
1-(3-ethoxy-1,1,2,2,3,3-hexafluoropropyl)piperidine (PubChem CID 18725560) has the molecular formula C10H15F6NO and a molecular weight of 279.22 g/mol. Its IUPAC name is 1-(3-ethoxy-1,1,2,2,3,3-hexafluoropropyl)piperidine.
| Compound Name | 1-(3-ethoxy-1,1,2,2,3,3-hexafluoropropyl)piperidine |
|---|---|
| PubChem CID | 18725560 |
| Molecular Formula | C10H15F6NO |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-(3-ethoxy-1,1,2,2,3,3-hexafluoropropyl)piperidine |
| SMILES | CCOC(F)(F)C(F)(F)C(F)(F)N1CCCCC1 |
| InChI | InChI=1S/C10H15F6NO/c1-2-18-10(15,16)8(11,12)9(13,14)17-6-4-3-5-7-17/h2-7H2,1H3 |
| InChIKey | RKTSEXPGHSGEKF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|