C15H20F11NO — CID 130418399
1-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]piperidine (PubChem CID 130418399) has the molecular formula C15H20F11NO and a molecular weight of 439.31 g/mol. Its IUPAC name is 1-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]piperidine.
| Compound Name | 1-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]piperidine |
|---|---|
| PubChem CID | 130418399 |
| Molecular Formula | C15H20F11NO |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 1-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]piperidine |
| SMILES | CC(OC(C)C(F)(C(F)N1CCCCC1)C(F)(F)F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C15H20F11NO/c1-8(28-9(2)13(19,20)10(16)14(21,22)23)12(18,15(24,25)26)11(17)27-6-4-3-5-7-27/h8-11H,3-7H2,1-2H3 |
| InChIKey | UGWGRKXQXYZVRS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|