C14H21F9N2O — CID 130418401
1-methyl-4-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]piperazine (PubChem CID 130418401) has the molecular formula C14H21F9N2O and a molecular weight of 404.32 g/mol. Its IUPAC name is 1-methyl-4-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]piperazine.
| Compound Name | 1-methyl-4-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]piperazine |
|---|---|
| PubChem CID | 130418401 |
| Molecular Formula | C14H21F9N2O |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 1-methyl-4-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]piperazine |
| SMILES | CC(OC(C)C(F)(F)C(F)C(F)(F)F)C(F)(F)C(F)N1CCN(C)CC1 |
| InChI | InChI=1S/C14H21F9N2O/c1-8(12(17,18)10(15)14(21,22)23)26-9(2)13(19,20)11(16)25-6-4-24(3)5-7-25/h8-11H,4-7H2,1-3H3 |
| InChIKey | QDUOGOBSXLSYDB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|