C14H18F11NO2 — CID 130418403
4-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]morpholine (PubChem CID 130418403) has the molecular formula C14H18F11NO2 and a molecular weight of 441.28 g/mol. Its IUPAC name is 4-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]morpholine.
| Compound Name | 4-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]morpholine |
|---|---|
| PubChem CID | 130418403 |
| Molecular Formula | C14H18F11NO2 |
| Molecular Weight | 441.28 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 4-[1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butyl]morpholine |
| SMILES | CC(OC(C)C(F)(C(F)N1CCOCC1)C(F)(F)F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C14H18F11NO2/c1-7(28-8(2)12(18,19)9(15)13(20,21)22)11(17,14(23,24)25)10(16)26-3-5-27-6-4-26/h7-10H,3-6H2,1-2H3 |
| InChIKey | HWMGINYTDWMFCV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|