C7H10F5NO — CID 131093423
4-[(2S)-1,1,1,3,3-pentafluoropropan-2-yl]morpholine (PubChem CID 131093423) has the molecular formula C7H10F5NO and a molecular weight of 219.15 g/mol. Its IUPAC name is 4-[(2S)-1,1,1,3,3-pentafluoropropan-2-yl]morpholine.
| Compound Name | 4-[(2S)-1,1,1,3,3-pentafluoropropan-2-yl]morpholine |
|---|---|
| PubChem CID | 131093423 |
| Molecular Formula | C7H10F5NO |
| Molecular Weight | 219.15 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 4-[(2S)-1,1,1,3,3-pentafluoropropan-2-yl]morpholine |
| SMILES | FC(F)[C@H](N1CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C7H10F5NO/c8-6(9)5(7(10,11)12)13-1-3-14-4-2-13/h5-6H,1-4H2/t5-/m0/s1 |
| InChIKey | JVUWLAQJVFWAQE-YFKPBYRVSA-N |
| XLogP | 1.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.15 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |