C10H17N3O2 — CID 12502867
2,2-dimorpholin-4-ylacetonitrile (PubChem CID 12502867) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2,2-dimorpholin-4-ylacetonitrile.
| Compound Name | 2,2-dimorpholin-4-ylacetonitrile |
|---|---|
| PubChem CID | 12502867 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 2,2-dimorpholin-4-ylacetonitrile |
| SMILES | N#CC(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C10H17N3O2/c11-9-10(12-1-5-14-6-2-12)13-3-7-15-8-4-13/h10H,1-8H2 |
| InChIKey | LTTKVCQTHFPVQX-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 48.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |