C7H15FN2O — CID 25158604
1-fluoro-N,N-dimethyl-1-morpholin-4-ylmethanamine (PubChem CID 25158604) has the molecular formula C7H15FN2O and a molecular weight of 162.21 g/mol. Its IUPAC name is 1-fluoro-N,N-dimethyl-1-morpholin-4-ylmethanamine.
| Compound Name | 1-fluoro-N,N-dimethyl-1-morpholin-4-ylmethanamine |
|---|---|
| PubChem CID | 25158604 |
| Molecular Formula | C7H15FN2O |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1-fluoro-N,N-dimethyl-1-morpholin-4-ylmethanamine |
| SMILES | CN(C)C(F)N1CCOCC1 |
| InChI | InChI=1S/C7H15FN2O/c1-9(2)7(8)10-3-5-11-6-4-10/h7H,3-6H2,1-2H3 |
| InChIKey | KLZDFNCUKXFXRK-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|