C14H18F9NO3 — CID 145366216
4-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)-6-methyl-1,4-dioxan-2-yl]ethyl]morpholine (PubChem CID 145366216) has the molecular formula C14H18F9NO3 and a molecular weight of 419.28 g/mol. Its IUPAC name is 4-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)-6-methyl-1,4-dioxan-2-yl]ethyl]morpholine.
| Compound Name | 4-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)-6-methyl-1,4-dioxan-2-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 145366216 |
| Molecular Formula | C14H18F9NO3 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 4-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)-6-methyl-1,4-dioxan-2-yl]ethyl]morpholine |
| SMILES | CC1(C(F)(F)C(F)C(F)(F)F)COCC(C(F)(F)C(F)N2CCOCC2)O1 |
| InChI | InChI=1S/C14H18F9NO3/c1-11(13(19,20)9(15)14(21,22)23)7-26-6-8(27-11)12(17,18)10(16)24-2-4-25-5-3-24/h8-10H,2-7H2,1H3 |
| InChIKey | SKUGYDNUJXHFBW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|