C18H24F11NO2 — CID 145366218
1-[1,2,3,3,3-pentafluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)-6-methyl-1,4-dioxepan-2-yl]propyl]azepane (PubChem CID 145366218) has the molecular formula C18H24F11NO2 and a molecular weight of 495.37 g/mol. Its IUPAC name is 1-[1,2,3,3,3-pentafluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)-6-methyl-1,4-dioxepan-2-yl]propyl]azepane.
| Compound Name | 1-[1,2,3,3,3-pentafluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)-6-methyl-1,4-dioxepan-2-yl]propyl]azepane |
|---|---|
| PubChem CID | 145366218 |
| Molecular Formula | C18H24F11NO2 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 1-[1,2,3,3,3-pentafluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)-6-methyl-1,4-dioxepan-2-yl]propyl]azepane |
| SMILES | CC1(C(F)(F)C(F)C(F)(F)F)COCC(C(F)(C(F)N2CCCCCC2)C(F)(F)F)OC1 |
| InChI | InChI=1S/C18H24F11NO2/c1-14(16(22,23)12(19)17(24,25)26)9-31-8-11(32-10-14)15(21,18(27,28)29)13(20)30-6-4-2-3-5-7-30/h11-13H,2-10H2,1H3 |
| InChIKey | KLCHQRQWWJNOIU-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|