C12H12F12 — CID 87672074
1,1-bis(1,1,2,3,3,3-hexafluoropropyl)cyclohexane (PubChem CID 87672074) has the molecular formula C12H12F12 and a molecular weight of 384.20 g/mol. Its IUPAC name is 1,1-bis(1,1,2,3,3,3-hexafluoropropyl)cyclohexane.
| Compound Name | 1,1-bis(1,1,2,3,3,3-hexafluoropropyl)cyclohexane |
|---|---|
| PubChem CID | 87672074 |
| Molecular Formula | C12H12F12 |
| Molecular Weight | 384.20 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 1,1-bis(1,1,2,3,3,3-hexafluoropropyl)cyclohexane |
| SMILES | FC(C(F)(F)F)C(F)(F)C1(C(F)(F)C(F)C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C12H12F12/c13-6(11(19,20)21)9(15,16)8(4-2-1-3-5-8)10(17,18)7(14)12(22,23)24/h6-7H,1-5H2 |
| InChIKey | PDLYCJFTNOPXNU-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.20 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |