C10H10F10 — CID 59927780
1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-(trifluoromethyl)cyclohexane (PubChem CID 59927780) has the molecular formula C10H10F10 and a molecular weight of 320.17 g/mol. Its IUPAC name is 1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-(trifluoromethyl)cyclohexane.
| Compound Name | 1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-(trifluoromethyl)cyclohexane |
|---|---|
| PubChem CID | 59927780 |
| Molecular Formula | C10H10F10 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-(trifluoromethyl)cyclohexane |
| SMILES | FC(F)(F)C1(C(F)(C(F)(F)F)C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C10H10F10/c11-7(9(15,16)17,10(18,19)20)6(8(12,13)14)4-2-1-3-5-6/h1-5H2 |
| InChIKey | ZQESCLNZHRLGMU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |