C13H19F9N2O — CID 130418452
1-(azepan-1-yl)-1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propan-1-amine (PubChem CID 130418452) has the molecular formula C13H19F9N2O and a molecular weight of 390.29 g/mol. Its IUPAC name is 1-(azepan-1-yl)-1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propan-1-amine.
| Compound Name | 1-(azepan-1-yl)-1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propan-1-amine |
|---|---|
| PubChem CID | 130418452 |
| Molecular Formula | C13H19F9N2O |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 1-(azepan-1-yl)-1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propan-1-amine |
| SMILES | NC(F)(N1CCCCCC1)C(F)(F)COCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C13H19F9N2O/c14-9(12(19,20)21)10(15,16)7-25-8-11(17,18)13(22,23)24-5-3-1-2-4-6-24/h9H,1-8,23H2 |
| InChIKey | BZDLFMSKVREWHJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|