C15H14F17NO — CID 137474498
1-[(2S)-1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]-3,5-bis(trifluoromethyl)piperidine (PubChem CID 137474498) has the molecular formula C15H14F17NO and a molecular weight of 547.25 g/mol. Its IUPAC name is 1-[(2S)-1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]-3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 1-[(2S)-1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]-3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 137474498 |
| Molecular Formula | C15H14F17NO |
| Molecular Weight | 547.25 g/mol |
| Exact Mass | 547.08 |
| IUPAC Name | 1-[(2S)-1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]-3,5-bis(trifluoromethyl)piperidine |
| SMILES | FC(C(F)(F)F)C(F)(F)COC[C@](F)(C(F)N1CC(C(F)(F)F)CC(C(F)(F)F)C1)C(F)(F)F |
| InChI | InChI=1S/C15H14F17NO/c16-8(14(27,28)29)11(19,20)5-34-4-10(18,15(30,31)32)9(17)33-2-6(12(21,22)23)1-7(3-33)13(24,25)26/h6-9H,1-5H2/t6?,7?,8?,9?,10-/m0/s1 |
| InChIKey | PEIJVFFOGRVFKF-XZXVQBCNSA-N |
| XLogP | 6.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.25 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|