C10H10F11NO — CID 130218799
4-(1,2,3,3,3-pentafluoro-2-methylpropyl)-2,6-bis(trifluoromethyl)morpholine (PubChem CID 130218799) has the molecular formula C10H10F11NO and a molecular weight of 369.17 g/mol. Its IUPAC name is 4-(1,2,3,3,3-pentafluoro-2-methylpropyl)-2,6-bis(trifluoromethyl)morpholine.
| Compound Name | 4-(1,2,3,3,3-pentafluoro-2-methylpropyl)-2,6-bis(trifluoromethyl)morpholine |
|---|---|
| PubChem CID | 130218799 |
| Molecular Formula | C10H10F11NO |
| Molecular Weight | 369.17 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 4-(1,2,3,3,3-pentafluoro-2-methylpropyl)-2,6-bis(trifluoromethyl)morpholine |
| SMILES | CC(F)(C(F)N1CC(C(F)(F)F)OC(C(F)(F)F)C1)C(F)(F)F |
| InChI | InChI=1S/C10H10F11NO/c1-7(12,10(19,20)21)6(11)22-2-4(8(13,14)15)23-5(3-22)9(16,17)18/h4-6H,2-3H2,1H3 |
| InChIKey | HMPUTYOKSMDZJZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.17 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|