C5H9F3N2O3S — CID 167049068
(5S)-2-methyl-5-(trifluoromethyl)-1,3-oxazolidine-3-sulfonamide (PubChem CID 167049068) has the molecular formula C5H9F3N2O3S and a molecular weight of 234.20 g/mol. Its IUPAC name is (5S)-2-methyl-5-(trifluoromethyl)-1,3-oxazolidine-3-sulfonamide.
| Compound Name | (5S)-2-methyl-5-(trifluoromethyl)-1,3-oxazolidine-3-sulfonamide |
|---|---|
| PubChem CID | 167049068 |
| Molecular Formula | C5H9F3N2O3S |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | (5S)-2-methyl-5-(trifluoromethyl)-1,3-oxazolidine-3-sulfonamide |
| SMILES | CC1O[C@H](C(F)(F)F)CN1S(N)(=O)=O |
| InChI | InChI=1S/C5H9F3N2O3S/c1-3-10(14(9,11)12)2-4(13-3)5(6,7)8/h3-4H,2H2,1H3,(H2,9,11,12)/t3?,4-/m0/s1 |
| InChIKey | WBDLDUTUUUAGAQ-BKLSDQPFSA-N |
| XLogP | -0.20 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |