C6H11F3N2O2S — CID 66570559
(2R)-2-(trifluoromethyl)piperidine-1-sulfonamide (PubChem CID 66570559) has the molecular formula C6H11F3N2O2S and a molecular weight of 232.23 g/mol. Its IUPAC name is (2R)-2-(trifluoromethyl)piperidine-1-sulfonamide.
| Compound Name | (2R)-2-(trifluoromethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 66570559 |
| Molecular Formula | C6H11F3N2O2S |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | (2R)-2-(trifluoromethyl)piperidine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCCC[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C6H11F3N2O2S/c7-6(8,9)5-3-1-2-4-11(5)14(10,12)13/h5H,1-4H2,(H2,10,12,13)/t5-/m1/s1 |
| InChIKey | OJHQRJFZBIFGDY-RXMQYKEDSA-N |
| XLogP | 0.61 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |