C7H10F3NO4S — CID 66262970
(2S)-1-(trifluoromethylsulfonyl)piperidine-2-carboxylic acid (PubChem CID 66262970) has the molecular formula C7H10F3NO4S and a molecular weight of 261.22 g/mol. Its IUPAC name is (2S)-1-(trifluoromethylsulfonyl)piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-(trifluoromethylsulfonyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 66262970 |
| Molecular Formula | C7H10F3NO4S |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | (2S)-1-(trifluoromethylsulfonyl)piperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCCN1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H10F3NO4S/c8-7(9,10)16(14,15)11-4-2-1-3-5(11)6(12)13/h5H,1-4H2,(H,12,13)/t5-/m0/s1 |
| InChIKey | ZNLLPMQRTMRMKK-YFKPBYRVSA-N |
| XLogP | 0.78 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |