C11H19NO6S2 — CID 66263114
(2S)-1-(1,1-dioxothian-4-yl)sulfonylpiperidine-2-carboxylic acid (PubChem CID 66263114) has the molecular formula C11H19NO6S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is (2S)-1-(1,1-dioxothian-4-yl)sulfonylpiperidine-2-carboxylic acid.
| Compound Name | (2S)-1-(1,1-dioxothian-4-yl)sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 66263114 |
| Molecular Formula | C11H19NO6S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | (2S)-1-(1,1-dioxothian-4-yl)sulfonylpiperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCCN1S(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H19NO6S2/c13-11(14)10-3-1-2-6-12(10)20(17,18)9-4-7-19(15,16)8-5-9/h9-10H,1-8H2,(H,13,14)/t10-/m0/s1 |
| InChIKey | FOPVTXAQWCECAD-JTQLQIEISA-N |
| XLogP | -0.17 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |