C12H21NO6S2 — CID 115539005
ethyl 1-(1,1-dioxothiolan-3-yl)sulfonylpiperidine-2-carboxylate (PubChem CID 115539005) has the molecular formula C12H21NO6S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is ethyl 1-(1,1-dioxothiolan-3-yl)sulfonylpiperidine-2-carboxylate.
| Compound Name | ethyl 1-(1,1-dioxothiolan-3-yl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 115539005 |
| Molecular Formula | C12H21NO6S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | ethyl 1-(1,1-dioxothiolan-3-yl)sulfonylpiperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1S(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H21NO6S2/c1-2-19-12(14)11-5-3-4-7-13(11)21(17,18)10-6-8-20(15,16)9-10/h10-11H,2-9H2,1H3 |
| InChIKey | NBQLQQFSXLGOCC-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |