C15H14F15NO2 — CID 130427257
4-[1,2,2-trifluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]ethyl]-2,6-bis(trifluoromethyl)morpholine (PubChem CID 130427257) has the molecular formula C15H14F15NO2 and a molecular weight of 525.25 g/mol. Its IUPAC name is 4-[1,2,2-trifluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]ethyl]-2,6-bis(trifluoromethyl)morpholine.
| Compound Name | 4-[1,2,2-trifluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]ethyl]-2,6-bis(trifluoromethyl)morpholine |
|---|---|
| PubChem CID | 130427257 |
| Molecular Formula | C15H14F15NO2 |
| Molecular Weight | 525.25 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | 4-[1,2,2-trifluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]ethyl]-2,6-bis(trifluoromethyl)morpholine |
| SMILES | FC(N1CC(C(F)(F)F)OC(C(F)(F)F)C1)C(F)(F)C1CCC(C(F)(F)C(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C15H14F15NO2/c16-9(15(28,29)30)11(18,19)5-1-2-6(32-5)12(20,21)10(17)31-3-7(13(22,23)24)33-8(4-31)14(25,26)27/h5-10H,1-4H2 |
| InChIKey | LWMMBSSKKOPBFF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.25 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|