C12H8F17NO — CID 130427256
1,1,1,3,3-pentafluoro-3-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]-N,N-bis(trifluoromethyl)propan-2-amine (PubChem CID 130427256) has the molecular formula C12H8F17NO and a molecular weight of 505.17 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoro-3-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]-N,N-bis(trifluoromethyl)propan-2-amine.
| Compound Name | 1,1,1,3,3-pentafluoro-3-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]-N,N-bis(trifluoromethyl)propan-2-amine |
|---|---|
| PubChem CID | 130427256 |
| Molecular Formula | C12H8F17NO |
| Molecular Weight | 505.17 g/mol |
| Exact Mass | 505.03 |
| IUPAC Name | 1,1,1,3,3-pentafluoro-3-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]-N,N-bis(trifluoromethyl)propan-2-amine |
| SMILES | FC(C(F)(F)F)C(F)(F)C1CCC(C(F)(F)C(N(C(F)(F)F)C(F)(F)F)C(F)(F)F)O1 |
| InChI | InChI=1S/C12H8F17NO/c13-5(9(18,19)20)7(14,15)3-1-2-4(31-3)8(16,17)6(10(21,22)23)30(11(24,25)26)12(27,28)29/h3-6H,1-2H2 |
| InChIKey | QIBLVYKZJATCAT-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.17 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|