C7H3F9 — CID 12758794
3,4,5,5,5-pentafluoro-3-(1,2,2,2-tetrafluoroethyl)pent-1-yne (PubChem CID 12758794) has the molecular formula C7H3F9 and a molecular weight of 258.08 g/mol. Its IUPAC name is 3,4,5,5,5-pentafluoro-3-(1,2,2,2-tetrafluoroethyl)pent-1-yne.
| Compound Name | 3,4,5,5,5-pentafluoro-3-(1,2,2,2-tetrafluoroethyl)pent-1-yne |
|---|---|
| PubChem CID | 12758794 |
| Molecular Formula | C7H3F9 |
| Molecular Weight | 258.08 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 3,4,5,5,5-pentafluoro-3-(1,2,2,2-tetrafluoroethyl)pent-1-yne |
| SMILES | C#CC(F)(C(F)C(F)(F)F)C(F)C(F)(F)F |
| InChI | InChI=1S/C7H3F9/c1-2-5(10,3(8)6(11,12)13)4(9)7(14,15)16/h1,3-4H |
| InChIKey | GSRCXWYASGJKBO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.08 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|