C15H18F11NO — CID 130427250
1-[1,2,3,3,3-pentafluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propyl]piperidine (PubChem CID 130427250) has the molecular formula C15H18F11NO and a molecular weight of 437.29 g/mol. Its IUPAC name is 1-[1,2,3,3,3-pentafluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propyl]piperidine.
| Compound Name | 1-[1,2,3,3,3-pentafluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propyl]piperidine |
|---|---|
| PubChem CID | 130427250 |
| Molecular Formula | C15H18F11NO |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 1-[1,2,3,3,3-pentafluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propyl]piperidine |
| SMILES | FC(C(F)(F)F)C(F)(F)C1CCC(C(F)(C(F)N2CCCCC2)C(F)(F)F)O1 |
| InChI | InChI=1S/C15H18F11NO/c16-10(14(21,22)23)13(19,20)9-5-4-8(28-9)12(18,15(24,25)26)11(17)27-6-2-1-3-7-27/h8-11H,1-7H2 |
| InChIKey | GQLCYYDJHPHFOY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|