C17H24F9NO2 — CID 145366235
1-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)-6-methyl-1,4-dioxepan-2-yl]ethyl]azepane (PubChem CID 145366235) has the molecular formula C17H24F9NO2 and a molecular weight of 445.37 g/mol. Its IUPAC name is 1-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)-6-methyl-1,4-dioxepan-2-yl]ethyl]azepane.
| Compound Name | 1-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)-6-methyl-1,4-dioxepan-2-yl]ethyl]azepane |
|---|---|
| PubChem CID | 145366235 |
| Molecular Formula | C17H24F9NO2 |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)-6-methyl-1,4-dioxepan-2-yl]ethyl]azepane |
| SMILES | CC1(C(F)(F)C(F)C(F)(F)F)COCC(C(F)(F)C(F)N2CCCCCC2)OC1 |
| InChI | InChI=1S/C17H24F9NO2/c1-14(16(22,23)12(18)17(24,25)26)9-28-8-11(29-10-14)15(20,21)13(19)27-6-4-2-3-5-7-27/h11-13H,2-10H2,1H3 |
| InChIKey | YOBBIXWYLAVCBE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|