C15H18F12N2O — CID 130427264
1-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]ethyl]-4-(trifluoromethyl)piperazine (PubChem CID 130427264) has the molecular formula C15H18F12N2O and a molecular weight of 470.30 g/mol. Its IUPAC name is 1-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]ethyl]-4-(trifluoromethyl)piperazine.
| Compound Name | 1-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]ethyl]-4-(trifluoromethyl)piperazine |
|---|---|
| PubChem CID | 130427264 |
| Molecular Formula | C15H18F12N2O |
| Molecular Weight | 470.30 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 1-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]ethyl]-4-(trifluoromethyl)piperazine |
| SMILES | FC(N1CCN(C(F)(F)F)CC1)C(F)(F)C1CCCC(C(F)(F)C(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C15H18F12N2O/c16-10(14(22,23)24)12(18,19)8-2-1-3-9(30-8)13(20,21)11(17)28-4-6-29(7-5-28)15(25,26)27/h8-11H,1-7H2 |
| InChIKey | MHNHUOCTDZKODG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|